C26H30N4O3 — CID 45272751
N-cyclohexyl-1-[[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-imine oxide (PubChem CID 45272751) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-cyclohexyl-1-[[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-imine oxide.
| Compound Name | N-cyclohexyl-1-[[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-imine oxide |
|---|---|
| PubChem CID | 45272751 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-cyclohexyl-1-[[1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-imine oxide |
| SMILES | COCCCn1c(CN2C(=O)/C(=[N+](/[O-])C3CCCCC3)c3ccccc32)nc2ccccc21 |
| InChI | InChI=1S/C26H30N4O3/c1-33-17-9-16-28-23-15-8-6-13-21(23)27-24(28)18-29-22-14-7-5-12-20(22)25(26(29)31)30(32)19-10-3-2-4-11-19/h5-8,12-15,19H,2-4,9-11,16-18H2,1H3/b30-25+ |
| InChIKey | RCSPQGGDAGZSOY-QCWLDUFUSA-N |
| XLogP | 4.25 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|