C29H27F2N5O4 — CID 74058227
methyl 4-[[[1-[[1-[2-(dimethylamino)ethyl]-5-fluorobenzimidazol-2-yl]methyl]-5-fluoro-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate (PubChem CID 74058227) has the molecular formula C29H27F2N5O4 and a molecular weight of 547.56 g/mol. Its IUPAC name is methyl 4-[[[1-[[1-[2-(dimethylamino)ethyl]-5-fluorobenzimidazol-2-yl]methyl]-5-fluoro-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate.
| Compound Name | methyl 4-[[[1-[[1-[2-(dimethylamino)ethyl]-5-fluorobenzimidazol-2-yl]methyl]-5-fluoro-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 74058227 |
| Molecular Formula | C29H27F2N5O4 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | methyl 4-[[[1-[[1-[2-(dimethylamino)ethyl]-5-fluorobenzimidazol-2-yl]methyl]-5-fluoro-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(CON=C2C(=O)N(Cc3nc4cc(F)ccc4n3CCN(C)C)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C29H27F2N5O4/c1-34(2)12-13-35-25-11-9-21(31)15-23(25)32-26(35)16-36-24-10-8-20(30)14-22(24)27(28(36)37)33-40-17-18-4-6-19(7-5-18)29(38)39-3/h4-11,14-15H,12-13,16-17H2,1-3H3 |
| InChIKey | RXMFBDFLARNWFI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|