C28H26F2N4O3S — CID 142159965
(3E)-5-fluoro-1-[[6-fluoro-1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfanylphenyl)methoxyimino]indol-2-one (PubChem CID 142159965) has the molecular formula C28H26F2N4O3S and a molecular weight of 536.60 g/mol. Its IUPAC name is (3E)-5-fluoro-1-[[6-fluoro-1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfanylphenyl)methoxyimino]indol-2-one.
| Compound Name | (3E)-5-fluoro-1-[[6-fluoro-1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfanylphenyl)methoxyimino]indol-2-one |
|---|---|
| PubChem CID | 142159965 |
| Molecular Formula | C28H26F2N4O3S |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (3E)-5-fluoro-1-[[6-fluoro-1-(3-methoxypropyl)benzimidazol-2-yl]methyl]-3-[(4-methylsulfanylphenyl)methoxyimino]indol-2-one |
| SMILES | COCCCn1c(CN2C(=O)/C(=N/OCc3ccc(SC)cc3)c3cc(F)ccc32)nc2ccc(F)cc21 |
| InChI | InChI=1S/C28H26F2N4O3S/c1-36-13-3-12-33-25-15-20(30)6-10-23(25)31-26(33)16-34-24-11-7-19(29)14-22(24)27(28(34)35)32-37-17-18-4-8-21(38-2)9-5-18/h4-11,14-15H,3,12-13,16-17H2,1-2H3/b32-27+ |
| InChIKey | SSFVOFYGXKAMQQ-QVAGMWBUSA-N |
| XLogP | 5.54 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|