C27H31NO3 — CID 102044079
[(2S)-5-(2-methoxyphenyl)-2-methylpentyl] N-benzyl-N-phenylcarbamate (PubChem CID 102044079) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(2S)-5-(2-methoxyphenyl)-2-methylpentyl] N-benzyl-N-phenylcarbamate.
| Compound Name | [(2S)-5-(2-methoxyphenyl)-2-methylpentyl] N-benzyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 102044079 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(2S)-5-(2-methoxyphenyl)-2-methylpentyl] N-benzyl-N-phenylcarbamate |
| SMILES | COc1ccccc1CCC[C@H](C)COC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO3/c1-22(12-11-16-24-15-9-10-19-26(24)30-2)21-31-27(29)28(25-17-7-4-8-18-25)20-23-13-5-3-6-14-23/h3-10,13-15,17-19,22H,11-12,16,20-21H2,1-2H3/t22-/m0/s1 |
| InChIKey | QTGKLOVKEJYGSS-QFIPXVFZSA-N |
| XLogP | 6.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |