C20H17NO3 — CID 102044844
(15S,19S)-1-[(1R)-1-hydroxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102044844) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (15S,19S)-1-[(1R)-1-hydroxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-1-[(1R)-1-hydroxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102044844 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (15S,19S)-1-[(1R)-1-hydroxyethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | C[C@@H](O)C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)NC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H17NO3/c1-10(22)20-13-8-4-2-6-11(13)15(12-7-3-5-9-14(12)20)16-17(20)19(24)21-18(16)23/h2-10,15-17,22H,1H3,(H,21,23,24)/t10-,15?,16+,17-,20?/m1/s1 |
| InChIKey | QEOYCTNTHJGPMM-KBVCRESISA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|