C28H22O10 — CID 102048418
4-(4,6-dicarboxy-2-ethoxynaphthalen-1-yl)-3-ethoxynaphthalene-1,7-dicarboxylic acid (PubChem CID 102048418) has the molecular formula C28H22O10 and a molecular weight of 518.47 g/mol. Its IUPAC name is 4-(4,6-dicarboxy-2-ethoxynaphthalen-1-yl)-3-ethoxynaphthalene-1,7-dicarboxylic acid.
| Compound Name | 4-(4,6-dicarboxy-2-ethoxynaphthalen-1-yl)-3-ethoxynaphthalene-1,7-dicarboxylic acid |
|---|---|
| PubChem CID | 102048418 |
| Molecular Formula | C28H22O10 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-(4,6-dicarboxy-2-ethoxynaphthalen-1-yl)-3-ethoxynaphthalene-1,7-dicarboxylic acid |
| SMILES | CCOc1cc(C(=O)O)c2cc(C(=O)O)ccc2c1-c1c(OCC)cc(C(=O)O)c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C28H22O10/c1-3-37-21-11-19(27(33)34)17-9-13(25(29)30)5-7-15(17)23(21)24-16-8-6-14(26(31)32)10-18(16)20(28(35)36)12-22(24)38-4-2/h5-12H,3-4H2,1-2H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | MLRQWDORVGLTMX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |