C22H38N6O10 — CID 102048464
4-oxo-4-[2-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethylamino]butanoic acid (PubChem CID 102048464) has the molecular formula C22H38N6O10 and a molecular weight of 546.58 g/mol. Its IUPAC name is 4-oxo-4-[2-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethylamino]butanoic acid.
| Compound Name | 4-oxo-4-[2-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 102048464 |
| Molecular Formula | C22H38N6O10 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 4-oxo-4-[2-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]ethylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H38N6O10/c29-17(1-2-19(31)32)23-3-4-24-18(30)13-25-5-7-26(14-20(33)34)9-11-28(16-22(37)38)12-10-27(8-6-25)15-21(35)36/h1-16H2,(H,23,29)(H,24,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | PAUKHVCHLHGUBL-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 220.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|