C14H12ClNO2S2 — CID 102049177
N-(4-chlorophenyl)-2-ethylsulfanyl-4-oxothiopyran-3-carboxamide (PubChem CID 102049177) has the molecular formula C14H12ClNO2S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-ethylsulfanyl-4-oxothiopyran-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-ethylsulfanyl-4-oxothiopyran-3-carboxamide |
|---|---|
| PubChem CID | 102049177 |
| Molecular Formula | C14H12ClNO2S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | N-(4-chlorophenyl)-2-ethylsulfanyl-4-oxothiopyran-3-carboxamide |
| SMILES | CCSc1sccc(=O)c1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClNO2S2/c1-2-19-14-12(11(17)7-8-20-14)13(18)16-10-5-3-9(15)4-6-10/h3-8H,2H2,1H3,(H,16,18) |
| InChIKey | SGGWWPASVQJIRV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |