C20H29NO6 — CID 102052620
ethyl (4S,5R)-5-cyclohexyl-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-4-nitrocyclopentene-1-carboxylate (PubChem CID 102052620) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is ethyl (4S,5R)-5-cyclohexyl-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-4-nitrocyclopentene-1-carboxylate.
| Compound Name | ethyl (4S,5R)-5-cyclohexyl-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-4-nitrocyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 102052620 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | ethyl (4S,5R)-5-cyclohexyl-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-4-nitrocyclopentene-1-carboxylate |
| SMILES | CCOC(=O)/C=C/C[C@]1([N+](=O)[O-])CC=C(C(=O)OCC)[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C20H29NO6/c1-3-26-17(22)11-8-13-20(21(24)25)14-12-16(19(23)27-4-2)18(20)15-9-6-5-7-10-15/h8,11-12,15,18H,3-7,9-10,13-14H2,1-2H3/b11-8+/t18-,20+/m1/s1 |
| InChIKey | ZAHIPCWGBHHUTQ-YGQKLEOUSA-N |
| XLogP | 3.60 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|