C11H17NO4 — CID 11053370
ethyl 6-(1-nitroethyl)cyclohexene-1-carboxylate (PubChem CID 11053370) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl 6-(1-nitroethyl)cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-(1-nitroethyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11053370 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl 6-(1-nitroethyl)cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C11H17NO4/c1-3-16-11(13)10-7-5-4-6-9(10)8(2)12(14)15/h7-9H,3-6H2,1-2H3 |
| InChIKey | AOHHERNQMVGYSY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|