C18H34O7Si — CID 102053536
[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-ethoxyethoxy)-3,6-dihydro-2H-pyran-3-yl] methyl carbonate (PubChem CID 102053536) has the molecular formula C18H34O7Si and a molecular weight of 390.55 g/mol. Its IUPAC name is [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-ethoxyethoxy)-3,6-dihydro-2H-pyran-3-yl] methyl carbonate.
| Compound Name | [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-ethoxyethoxy)-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 102053536 |
| Molecular Formula | C18H34O7Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-ethoxyethoxy)-3,6-dihydro-2H-pyran-3-yl] methyl carbonate |
| SMILES | CCOCCOC1C=CC(OC(=O)OC)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H34O7Si/c1-8-21-11-12-22-16-10-9-14(25-17(19)20-5)15(24-16)13-23-26(6,7)18(2,3)4/h9-10,14-16H,8,11-13H2,1-7H3/t14?,15-,16?/m1/s1 |
| InChIKey | DHZWSGBNEYLFFA-HWOWSKLDSA-N |
| XLogP | 3.49 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|