About 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile
4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile (PubChem CID 102053842) has the molecular formula C19H14Cl2N4
and a molecular weight of 369.26 g/mol. Its IUPAC name is 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile |
| PubChem CID | 102053842 |
| Molecular Formula | C19H14Cl2N4 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CN(Cc3ccc(C#N)cc3)C(Cl)=C2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N4/c20-18-19(21)25(12-17-7-3-15(10-23)4-8-17)13-24(18)11-16-5-1-14(9-22)2-6-16/h1-8H,11-13H2 |
| InChIKey | JIJDVQYFTRGBLC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile?
The IUPAC name of 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile (CID 102053842) is 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile is N#Cc1ccc(CN2CN(Cc3ccc(C#N)cc3)C(Cl)=C2Cl)cc1.
What is the InChIKey of 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile?
The InChIKey is JIJDVQYFTRGBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N4/c20-18-19(21)25(12-17-7-3-15(10-23)4-8-17)13-24(18)11-16-5-1-14(9-22)2-6-16/h1-8H,11-13H2.
What are the key properties of 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile?
4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile has a molecular weight of 369.26 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile is sourced from PubChem (CID 102053842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).