C19H14Cl2N4 — CID 102053842
4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile (PubChem CID 102053842) has the molecular formula C19H14Cl2N4 and a molecular weight of 369.26 g/mol. Its IUPAC name is 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 102053842 |
| Molecular Formula | C19H14Cl2N4 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[[4,5-dichloro-3-[(4-cyanophenyl)methyl]-2H-imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CN(Cc3ccc(C#N)cc3)C(Cl)=C2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N4/c20-18-19(21)25(12-17-7-3-15(10-23)4-8-17)13-24(18)11-16-5-1-14(9-22)2-6-16/h1-8H,11-13H2 |
| InChIKey | JIJDVQYFTRGBLC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|