C17H22O4 — CID 102054597
(1R,4S,7S,8R,12S)-12-hydroxy-4-methyl-7-prop-1-en-2-yl-3,14-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one (PubChem CID 102054597) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1R,4S,7S,8R,12S)-12-hydroxy-4-methyl-7-prop-1-en-2-yl-3,14-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one.
| Compound Name | (1R,4S,7S,8R,12S)-12-hydroxy-4-methyl-7-prop-1-en-2-yl-3,14-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one |
|---|---|
| PubChem CID | 102054597 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1R,4S,7S,8R,12S)-12-hydroxy-4-methyl-7-prop-1-en-2-yl-3,14-dioxatetracyclo[10.2.1.02,10.04,8]pentadec-2(10)-en-11-one |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)OC3=C(C[C@H]12)C(=O)[C@@]1(O)CO[C@@H]3C1 |
| InChI | InChI=1S/C17H22O4/c1-9(2)10-4-5-16(3)12(10)6-11-14(21-16)13-7-17(19,8-20-13)15(11)18/h10,12-13,19H,1,4-8H2,2-3H3/t10-,12-,13-,16+,17+/m1/s1 |
| InChIKey | PDDUOBCTLLRRFF-GTOWQFAVSA-N |
| XLogP | 2.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|