C13H22O — CID 121004169
2-methyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)oxirane (PubChem CID 121004169) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-methyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)oxirane.
| Compound Name | 2-methyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)oxirane |
|---|---|
| PubChem CID | 121004169 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2-methyl-2-(5-methyl-2-prop-1-en-2-ylcyclohexyl)oxirane |
| SMILES | C=C(C)C1CCC(C)CC1C1(C)CO1 |
| InChI | InChI=1S/C13H22O/c1-9(2)11-6-5-10(3)7-12(11)13(4)8-14-13/h10-12H,1,5-8H2,2-4H3 |
| InChIKey | VWUCIGRCIQBXNW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|