C15H24O — CID 134962165
(3aS,4R,7R,7aS)-1a,4-dimethyl-7-prop-1-en-2-yl-3,3a,4,5,6,7,7a,7b-octahydro-2H-naphtho[1,2-b]oxirene (PubChem CID 134962165) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-1a,4-dimethyl-7-prop-1-en-2-yl-3,3a,4,5,6,7,7a,7b-octahydro-2H-naphtho[1,2-b]oxirene.
| Compound Name | (3aS,4R,7R,7aS)-1a,4-dimethyl-7-prop-1-en-2-yl-3,3a,4,5,6,7,7a,7b-octahydro-2H-naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 134962165 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3aS,4R,7R,7aS)-1a,4-dimethyl-7-prop-1-en-2-yl-3,3a,4,5,6,7,7a,7b-octahydro-2H-naphtho[1,2-b]oxirene |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@@H]2CCC3(C)OC3[C@@H]21 |
| InChI | InChI=1S/C15H24O/c1-9(2)11-6-5-10(3)12-7-8-15(4)14(16-15)13(11)12/h10-14H,1,5-8H2,2-4H3/t10-,11+,12+,13-,14?,15?/m1/s1 |
| InChIKey | NVJMEJNOZCYMRG-VCKHUVBKSA-N |
| XLogP | 3.79 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|