C31H29NO — CID 102054852
(2R,3R)-2-ethenyl-3-(phenylmethoxymethyl)-1-tritylaziridine (PubChem CID 102054852) has the molecular formula C31H29NO and a molecular weight of 431.58 g/mol. Its IUPAC name is (2R,3R)-2-ethenyl-3-(phenylmethoxymethyl)-1-tritylaziridine.
| Compound Name | (2R,3R)-2-ethenyl-3-(phenylmethoxymethyl)-1-tritylaziridine |
|---|---|
| PubChem CID | 102054852 |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2R,3R)-2-ethenyl-3-(phenylmethoxymethyl)-1-tritylaziridine |
| SMILES | C=C[C@@H]1[C@H](COCc2ccccc2)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NO/c1-2-29-30(24-33-23-25-15-7-3-8-16-25)32(29)31(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h2-22,29-30H,1,23-24H2/t29-,30+,32?/m1/s1 |
| InChIKey | OLQRIHPNKYMBII-CLZOGUKSSA-N |
| XLogP | 6.43 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|