C29H33N3O3 — CID 10205502
3-[[4-(diethylcarbamoyl)phenyl]-[1-(furan-3-ylmethyl)piperidin-4-ylidene]methyl]benzamide (PubChem CID 10205502) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-[[4-(diethylcarbamoyl)phenyl]-[1-(furan-3-ylmethyl)piperidin-4-ylidene]methyl]benzamide.
| Compound Name | 3-[[4-(diethylcarbamoyl)phenyl]-[1-(furan-3-ylmethyl)piperidin-4-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 10205502 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3-[[4-(diethylcarbamoyl)phenyl]-[1-(furan-3-ylmethyl)piperidin-4-ylidene]methyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCN(Cc3ccoc3)CC2)c2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-3-32(4-2)29(34)24-10-8-22(9-11-24)27(25-6-5-7-26(18-25)28(30)33)23-12-15-31(16-13-23)19-21-14-17-35-20-21/h5-11,14,17-18,20H,3-4,12-13,15-16,19H2,1-2H3,(H2,30,33) |
| InChIKey | MWBMMENEYRKEAK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |