C20H32O4 — CID 102056174
(1R,3R,4S,9S,10R,12S,13S)-3,13-dihydroxy-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecan-6-one (PubChem CID 102056174) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,3R,4S,9S,10R,12S,13S)-3,13-dihydroxy-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecan-6-one.
| Compound Name | (1R,3R,4S,9S,10R,12S,13S)-3,13-dihydroxy-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecan-6-one |
|---|---|
| PubChem CID | 102056174 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1R,3R,4S,9S,10R,12S,13S)-3,13-dihydroxy-13-(hydroxymethyl)-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecan-6-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@@H]1[C@H](O)C[C@@]13CC[C@@H](C[C@H]12)[C@](O)(CO)C3 |
| InChI | InChI=1S/C20H32O4/c1-17(2)15(23)5-6-18(3)14-8-12-4-7-19(14,9-13(22)16(17)18)10-20(12,24)11-21/h12-14,16,21-22,24H,4-11H2,1-3H3/t12-,13+,14-,16+,18-,19+,20+/m0/s1 |
| InChIKey | MIGVEZTXNXZEOW-FTLCDWARSA-N |
| XLogP | 2.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |