C30H50O4 — CID 91613138
(5S,6S,8R,9R,10R,13S,14S,17S)-17-[(2S)-2,7-dihydroxy-6-methylhept-5-en-2-yl]-6-hydroxy-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91613138) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (5S,6S,8R,9R,10R,13S,14S,17S)-17-[(2S)-2,7-dihydroxy-6-methylhept-5-en-2-yl]-6-hydroxy-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,6S,8R,9R,10R,13S,14S,17S)-17-[(2S)-2,7-dihydroxy-6-methylhept-5-en-2-yl]-6-hydroxy-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91613138 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (5S,6S,8R,9R,10R,13S,14S,17S)-17-[(2S)-2,7-dihydroxy-6-methylhept-5-en-2-yl]-6-hydroxy-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=CCC[C@](C)(O)[C@H]1CC[C@@]2(C)[C@H]1CC[C@@H]1[C@@]3(C)CCC(=O)C(C)(C)[C@H]3[C@@H](O)C[C@]12C)CO |
| InChI | InChI=1S/C30H50O4/c1-19(18-31)9-8-14-30(7,34)21-12-16-28(5)20(21)10-11-23-27(4)15-13-24(33)26(2,3)25(27)22(32)17-29(23,28)6/h9,20-23,25,31-32,34H,8,10-18H2,1-7H3/t20-,21-,22-,23+,25+,27+,28-,29+,30-/m0/s1 |
| InChIKey | OJUCPLZVFCNHRO-SSDGHBMBSA-N |
| XLogP | 5.68 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|