C28H44O4S2 — CID 144842206
(6S,9R,14R)-6-hydroxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,14-trimethyl-8,10-bis(sulfanyl)-2,5,6,7,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,12-dione (PubChem CID 144842206) has the molecular formula C28H44O4S2 and a molecular weight of 508.79 g/mol. Its IUPAC name is (6S,9R,14R)-6-hydroxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,14-trimethyl-8,10-bis(sulfanyl)-2,5,6,7,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,12-dione.
| Compound Name | (6S,9R,14R)-6-hydroxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,14-trimethyl-8,10-bis(sulfanyl)-2,5,6,7,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,12-dione |
|---|---|
| PubChem CID | 144842206 |
| Molecular Formula | C28H44O4S2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (6S,9R,14R)-6-hydroxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,14-trimethyl-8,10-bis(sulfanyl)-2,5,6,7,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,12-dione |
| SMILES | CC(C)=CCCC(C)(O)C1CC[C@]2(C)C1C(=O)C[C@@H]1C3(S)CCC(=O)C(C)(C)C3[C@@H](O)CC12S |
| InChI | InChI=1S/C28H44O4S2/c1-16(2)8-7-11-26(6,32)17-9-12-25(5)22(17)18(29)14-20-27(33)13-10-21(31)24(3,4)23(27)19(30)15-28(20,25)34/h8,17,19-20,22-23,30,32-34H,7,9-15H2,1-6H3/t17?,19-,20+,22?,23?,25+,26?,27?,28?/m0/s1 |
| InChIKey | WFZMXZNIBUGBHS-HGKFVAMJSA-N |
| XLogP | 5.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|