C31H52O3 — CID 162856607
(5R,8R,9R,10R,13R,14R,17S)-17-[(2S)-2,7-dihydroxy-7-methyloct-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162856607) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (5R,8R,9R,10R,13R,14R,17S)-17-[(2S)-2,7-dihydroxy-7-methyloct-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,8R,9R,10R,13R,14R,17S)-17-[(2S)-2,7-dihydroxy-7-methyloct-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162856607 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (5R,8R,9R,10R,13R,14R,17S)-17-[(2S)-2,7-dihydroxy-7-methyloct-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(O)C=CCC[C@](C)(O)[C@H]1CC[C@]2(C)[C@@H]1CC[C@@H]1[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O3/c1-26(2,33)16-9-10-17-31(8,34)22-13-19-29(6)21(22)11-12-24-28(5)18-15-25(32)27(3,4)23(28)14-20-30(24,29)7/h9,16,21-24,33-34H,10-15,17-20H2,1-8H3/t21-,22+,23+,24-,28+,29-,30-,31+/m1/s1 |
| InChIKey | JNFPBYRTIMWVMA-LZNQQYLFSA-N |
| XLogP | 7.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|