C14H25F3N2O — CID 102056444
(3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluorononan-2-one (PubChem CID 102056444) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluorononan-2-one.
| Compound Name | (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluorononan-2-one |
|---|---|
| PubChem CID | 102056444 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3Z)-3-[tert-butyl(methyl)hydrazinylidene]-1,1,1-trifluorononan-2-one |
| SMILES | CCCCCC/C(=N/N(C)C(C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3N2O/c1-6-7-8-9-10-11(12(20)14(15,16)17)18-19(5)13(2,3)4/h6-10H2,1-5H3/b18-11- |
| InChIKey | VQXDNUKLNKFKJA-WQRHYEAKSA-N |
| XLogP | 4.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|