C14H14O4 — CID 102056803
2,4,8,8-tetramethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione (PubChem CID 102056803) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2,4,8,8-tetramethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione.
| Compound Name | 2,4,8,8-tetramethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
|---|---|
| PubChem CID | 102056803 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2,4,8,8-tetramethyl-8aH-furo[3,4-f][1]benzofuran-5,7-dione |
| SMILES | CC1=CC2=C(C)C3=C(C(=O)OC3=O)C(C)(C)C2O1 |
| InChI | InChI=1S/C14H14O4/c1-6-5-8-7(2)9-10(13(16)18-12(9)15)14(3,4)11(8)17-6/h5,11H,1-4H3 |
| InChIKey | ZUAISLWVBISHLQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|