C9H11N3NaO7P — CID 102057177
sodium 1-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-iminopyrimidin-2-olate (PubChem CID 102057177) has the molecular formula C9H11N3NaO7P and a molecular weight of 327.17 g/mol. Its IUPAC name is sodium 1-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-iminopyrimidin-2-olate.
| Compound Name | sodium 1-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-iminopyrimidin-2-olate |
|---|---|
| PubChem CID | 102057177 |
| Molecular Formula | C9H11N3NaO7P |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | sodium 1-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-iminopyrimidin-2-olate |
| SMILES | [H]/N=c1\ccn([C@@H]2O[C@@H]3COP(=O)(O)O[C@H]3[C@H]2O)c([O-])n1.[Na+] |
| InChI | InChI=1S/C9H12N3O7P.Na/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7;/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14);/q;+1/p-1/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | RZAHVNCNTLFRHJ-IAIGYFSYSA-M |
| XLogP | -4.79 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|