C24H26ClNO5S — CID 10205792
4-[[5-chloro-4-methyl-2-[(5-methylfuran-2-yl)sulfanyl-propan-2-ylamino]phenoxy]methyl]-3-methoxybenzoic acid (PubChem CID 10205792) has the molecular formula C24H26ClNO5S and a molecular weight of 475.99 g/mol. Its IUPAC name is 4-[[5-chloro-4-methyl-2-[(5-methylfuran-2-yl)sulfanyl-propan-2-ylamino]phenoxy]methyl]-3-methoxybenzoic acid.
| Compound Name | 4-[[5-chloro-4-methyl-2-[(5-methylfuran-2-yl)sulfanyl-propan-2-ylamino]phenoxy]methyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 10205792 |
| Molecular Formula | C24H26ClNO5S |
| Molecular Weight | 475.99 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 4-[[5-chloro-4-methyl-2-[(5-methylfuran-2-yl)sulfanyl-propan-2-ylamino]phenoxy]methyl]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1COc1cc(Cl)c(C)cc1N(Sc1ccc(C)o1)C(C)C |
| InChI | InChI=1S/C24H26ClNO5S/c1-14(2)26(32-23-9-6-16(4)31-23)20-10-15(3)19(25)12-22(20)30-13-18-8-7-17(24(27)28)11-21(18)29-5/h6-12,14H,13H2,1-5H3,(H,27,28) |
| InChIKey | NHYHVROQXGFJCN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.99 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|