C37H36N2O2 — CID 102058942
(3R)-11-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole (PubChem CID 102058942) has the molecular formula C37H36N2O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is (3R)-11-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole.
| Compound Name | (3R)-11-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 102058942 |
| Molecular Formula | C37H36N2O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | (3R)-11-[(1-methoxy-9H-carbazol-3-yl)methyl]-3,5-dimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole |
| SMILES | COc1cc(Cn2c3ccccc3c3cc(C)c4c(c32)C=C[C@@](C)(CCC=C(C)C)O4)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C37H36N2O2/c1-23(2)11-10-17-37(4)18-16-28-35-30(19-24(3)36(28)41-37)27-13-7-9-15-32(27)39(35)22-25-20-29-26-12-6-8-14-31(26)38-34(29)33(21-25)40-5/h6-9,11-16,18-21,38H,10,17,22H2,1-5H3/t37-/m1/s1 |
| InChIKey | WZDZCOAWFXDCTD-DIPNUNPCSA-N |
| XLogP | 9.71 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|