C18H28ClN5O6S — CID 10205910
(3R)-3-[[2-[[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]acetyl]amino]acetyl]amino]-4-chlorobutanoic acid (PubChem CID 10205910) has the molecular formula C18H28ClN5O6S and a molecular weight of 477.97 g/mol. Its IUPAC name is (3R)-3-[[2-[[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]acetyl]amino]acetyl]amino]-4-chlorobutanoic acid.
| Compound Name | (3R)-3-[[2-[[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]acetyl]amino]acetyl]amino]-4-chlorobutanoic acid |
|---|---|
| PubChem CID | 10205910 |
| Molecular Formula | C18H28ClN5O6S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (3R)-3-[[2-[[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]acetyl]amino]acetyl]amino]-4-chlorobutanoic acid |
| SMILES | O=C(O)C[C@H](CCl)NC(=O)CNC(=O)CNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C18H28ClN5O6S/c19-6-10(5-16(28)29)22-15(27)8-21-14(26)7-20-13(25)4-2-1-3-12-17-11(9-31-12)23-18(30)24-17/h10-12,17H,1-9H2,(H,20,25)(H,21,26)(H,22,27)(H,28,29)(H2,23,24,30)/t10-,11-,12-,17-/m1/s1 |
| InChIKey | PQTLDKFLODBQNJ-BDBYMAIGSA-N |
| XLogP | -0.86 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|