C16H28N4O5S — CID 178169151
N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 178169151) has the molecular formula C16H28N4O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 178169151 |
| Molecular Formula | C16H28N4O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCC(=O)NC(CO)CO |
| InChI | InChI=1S/C16H28N4O5S/c21-7-10(8-22)18-14(24)5-6-17-13(23)4-2-1-3-12-15-11(9-26-12)19-16(25)20-15/h10-12,15,21-22H,1-9H2,(H,17,23)(H,18,24)(H2,19,20,25) |
| InChIKey | ODILJDNATHWMIM-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|