C26H46N4O4S — CID 143347452
N-[(E)-13-acetamido-14-hydroxytetradec-10-enyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 143347452) has the molecular formula C26H46N4O4S and a molecular weight of 510.75 g/mol. Its IUPAC name is N-[(E)-13-acetamido-14-hydroxytetradec-10-enyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[(E)-13-acetamido-14-hydroxytetradec-10-enyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 143347452 |
| Molecular Formula | C26H46N4O4S |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | N-[(E)-13-acetamido-14-hydroxytetradec-10-enyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | CC(=O)NC(CO)C/C=C/CCCCCCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C26H46N4O4S/c1-20(32)28-21(18-31)14-10-8-6-4-2-3-5-7-9-13-17-27-24(33)16-12-11-15-23-25-22(19-35-23)29-26(34)30-25/h8,10,21-23,25,31H,2-7,9,11-19H2,1H3,(H,27,33)(H,28,32)(H2,29,30,34)/b10-8+ |
| InChIKey | AIROWAUHXXNJMK-CSKARUKUSA-N |
| XLogP | 3.39 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|