C30H49NO4 — CID 102061165
[(8S,9S,10S,13R,14S,17R)-10-(carbamoyloxymethyl)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 102061165) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is [(8S,9S,10S,13R,14S,17R)-10-(carbamoyloxymethyl)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10S,13R,14S,17R)-10-(carbamoyloxymethyl)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 102061165 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | [(8S,9S,10S,13R,14S,17R)-10-(carbamoyloxymethyl)-13-methyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(COC(N)=O)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H49NO4/c1-19(2)7-6-8-20(3)25-11-12-26-24-10-9-22-17-23(35-21(4)32)13-16-30(22,18-34-28(31)33)27(24)14-15-29(25,26)5/h9,19-20,23-27H,6-8,10-18H2,1-5H3,(H2,31,33)/t20-,23?,24+,25-,26+,27+,29-,30-/m1/s1 |
| InChIKey | KFDBNJULLDDEIM-YBWBGXRQSA-N |
| XLogP | 7.03 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|