C22H16F26O4 — CID 102065187
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-[2-[2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-en-2-yloxy)ethoxy]ethoxy]ethoxy]oct-1-ene (PubChem CID 102065187) has the molecular formula C22H16F26O4 and a molecular weight of 838.31 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-[2-[2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-en-2-yloxy)ethoxy]ethoxy]ethoxy]oct-1-ene.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-[2-[2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-en-2-yloxy)ethoxy]ethoxy]ethoxy]oct-1-ene |
|---|---|
| PubChem CID | 102065187 |
| Molecular Formula | C22H16F26O4 |
| Molecular Weight | 838.31 g/mol |
| Exact Mass | 838.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-[2-[2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-en-2-yloxy)ethoxy]ethoxy]ethoxy]oct-1-ene |
| SMILES | C=C(OCCOCCOCCOC(=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H16F26O4/c1-9(11(23,24)13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)45)51-7-5-49-3-4-50-6-8-52-10(2)12(25,26)14(29,30)16(33,34)18(37,38)20(41,42)22(46,47)48/h1-8H2 |
| InChIKey | NAMHHBWBHPOBKR-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.31 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|