C21H16O — CID 102065591
3-(2-cyclohepta-2,4,6-trien-1-ylphenyl)-1-benzofuran (PubChem CID 102065591) has the molecular formula C21H16O and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-(2-cyclohepta-2,4,6-trien-1-ylphenyl)-1-benzofuran.
| Compound Name | 3-(2-cyclohepta-2,4,6-trien-1-ylphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 102065591 |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(2-cyclohepta-2,4,6-trien-1-ylphenyl)-1-benzofuran |
| SMILES | C1=CC=CC(c2ccccc2-c2coc3ccccc23)C=C1 |
| InChI | InChI=1S/C21H16O/c1-2-4-10-16(9-3-1)17-11-5-6-12-18(17)20-15-22-21-14-8-7-13-19(20)21/h1-16H |
| InChIKey | GQVHWEGBHPJVPH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |