C18H26O3 — CID 102066620
(1R,4S,5R,6S)-5,6-di(pentanoyl)bicyclo[2.2.1]hept-2-ene-7-carbaldehyde (PubChem CID 102066620) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1R,4S,5R,6S)-5,6-di(pentanoyl)bicyclo[2.2.1]hept-2-ene-7-carbaldehyde.
| Compound Name | (1R,4S,5R,6S)-5,6-di(pentanoyl)bicyclo[2.2.1]hept-2-ene-7-carbaldehyde |
|---|---|
| PubChem CID | 102066620 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1R,4S,5R,6S)-5,6-di(pentanoyl)bicyclo[2.2.1]hept-2-ene-7-carbaldehyde |
| SMILES | CCCCC(=O)[C@@H]1[C@H](C(=O)CCCC)[C@H]2C=C[C@@H]1C2C=O |
| InChI | InChI=1S/C18H26O3/c1-3-5-7-15(20)17-12-9-10-13(14(12)11-19)18(17)16(21)8-6-4-2/h9-14,17-18H,3-8H2,1-2H3/t12-,13+,14?,17-,18+ |
| InChIKey | GYROZPMIJIESEN-SLFYWEJWSA-N |
| XLogP | 3.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|