C17H26O2 — CID 10682994
1-[(1R,2S,3R,4S)-3-deuteriocarbonyl-2-bicyclo[2.2.1]hept-5-enyl]nonan-1-one (PubChem CID 10682994) has the molecular formula C17H26O2 and a molecular weight of 263.40 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4S)-3-deuteriocarbonyl-2-bicyclo[2.2.1]hept-5-enyl]nonan-1-one.
| Compound Name | 1-[(1R,2S,3R,4S)-3-deuteriocarbonyl-2-bicyclo[2.2.1]hept-5-enyl]nonan-1-one |
|---|---|
| PubChem CID | 10682994 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-[(1R,2S,3R,4S)-3-deuteriocarbonyl-2-bicyclo[2.2.1]hept-5-enyl]nonan-1-one |
| SMILES | [2H]C(=O)[C@H]1[C@@H](C(=O)CCCCCCCC)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H26O2/c1-2-3-4-5-6-7-8-16(19)17-14-10-9-13(11-14)15(17)12-18/h9-10,12-15,17H,2-8,11H2,1H3/t13-,14+,15-,17+/m1/s1/i12D |
| InChIKey | VYGBIFBMMIGYMV-FTCQQQCESA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|