C11H9Cl2NO6 — CID 102066979
[acetyloxy-(2,4-dichloro-5-nitrophenyl)methyl] acetate (PubChem CID 102066979) has the molecular formula C11H9Cl2NO6 and a molecular weight of 322.10 g/mol. Its IUPAC name is [acetyloxy-(2,4-dichloro-5-nitrophenyl)methyl] acetate.
| Compound Name | [acetyloxy-(2,4-dichloro-5-nitrophenyl)methyl] acetate |
|---|---|
| PubChem CID | 102066979 |
| Molecular Formula | C11H9Cl2NO6 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | [acetyloxy-(2,4-dichloro-5-nitrophenyl)methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2NO6/c1-5(15)19-11(20-6(2)16)7-3-10(14(17)18)9(13)4-8(7)12/h3-4,11H,1-2H3 |
| InChIKey | OXSLEBWOKNYRIK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|