C10H18OS2 — CID 102067963
(E)-1-methylsulfanyl-1-prop-2-enylsulfanylhex-1-en-3-ol (PubChem CID 102067963) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is (E)-1-methylsulfanyl-1-prop-2-enylsulfanylhex-1-en-3-ol.
| Compound Name | (E)-1-methylsulfanyl-1-prop-2-enylsulfanylhex-1-en-3-ol |
|---|---|
| PubChem CID | 102067963 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (E)-1-methylsulfanyl-1-prop-2-enylsulfanylhex-1-en-3-ol |
| SMILES | C=CCS/C(=C/C(O)CCC)SC |
| InChI | InChI=1S/C10H18OS2/c1-4-6-9(11)8-10(12-3)13-7-5-2/h5,8-9,11H,2,4,6-7H2,1,3H3/b10-8+ |
| InChIKey | IGFKDAVBOGCQFR-CSKARUKUSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|