C19H23N3O6 — CID 102068062
ditert-butyl 1-(2-nitrophenyl)imidazole-4,5-dicarboxylate (PubChem CID 102068062) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is ditert-butyl 1-(2-nitrophenyl)imidazole-4,5-dicarboxylate.
| Compound Name | ditert-butyl 1-(2-nitrophenyl)imidazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102068062 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ditert-butyl 1-(2-nitrophenyl)imidazole-4,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ncn(-c2ccccc2[N+](=O)[O-])c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23N3O6/c1-18(2,3)27-16(23)14-15(17(24)28-19(4,5)6)21(11-20-14)12-9-7-8-10-13(12)22(25)26/h7-11H,1-6H3 |
| InChIKey | HZIRTHKQZIEKKC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|