C11H10N4O3 — CID 14615576
N-[1-(2-nitrophenyl)pyrazol-3-yl]acetamide (PubChem CID 14615576) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[1-(2-nitrophenyl)pyrazol-3-yl]acetamide.
| Compound Name | N-[1-(2-nitrophenyl)pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 14615576 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[1-(2-nitrophenyl)pyrazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccn(-c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10N4O3/c1-8(16)12-11-6-7-14(13-11)9-4-2-3-5-10(9)15(17)18/h2-7H,1H3,(H,12,13,16) |
| InChIKey | RSCVURUKORQFNB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|