C18H22N4O6 — CID 120689207
4-[(2-methylpropan-2-yl)oxy]-2-[[1-(2-nitrophenyl)pyrazole-3-carbonyl]amino]butanoic acid (PubChem CID 120689207) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-2-[[1-(2-nitrophenyl)pyrazole-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-2-[[1-(2-nitrophenyl)pyrazole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120689207 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-2-[[1-(2-nitrophenyl)pyrazole-3-carbonyl]amino]butanoic acid |
| SMILES | CC(C)(C)OCCC(NC(=O)c1ccn(-c2ccccc2[N+](=O)[O-])n1)C(=O)O |
| InChI | InChI=1S/C18H22N4O6/c1-18(2,3)28-11-9-13(17(24)25)19-16(23)12-8-10-21(20-12)14-6-4-5-7-15(14)22(26)27/h4-8,10,13H,9,11H2,1-3H3,(H,19,23)(H,24,25) |
| InChIKey | MOYZVGNNHPESNG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|