C15H17N3O4 — CID 120702722
4-methoxy-2-[(1-phenylpyrazole-3-carbonyl)amino]butanoic acid (PubChem CID 120702722) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-methoxy-2-[(1-phenylpyrazole-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(1-phenylpyrazole-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120702722 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-methoxy-2-[(1-phenylpyrazole-3-carbonyl)amino]butanoic acid |
| SMILES | COCCC(NC(=O)c1ccn(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C15H17N3O4/c1-22-10-8-13(15(20)21)16-14(19)12-7-9-18(17-12)11-5-3-2-4-6-11/h2-7,9,13H,8,10H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | NNZFCDQXUVUOPY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |