C16H19N3O3 — CID 119211592
3-methyl-2-[(1-phenylpyrazole-3-carbonyl)amino]pentanoic acid (PubChem CID 119211592) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-methyl-2-[(1-phenylpyrazole-3-carbonyl)amino]pentanoic acid.
| Compound Name | 3-methyl-2-[(1-phenylpyrazole-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119211592 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-methyl-2-[(1-phenylpyrazole-3-carbonyl)amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1ccn(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C16H19N3O3/c1-3-11(2)14(16(21)22)17-15(20)13-9-10-19(18-13)12-7-5-4-6-8-12/h4-11,14H,3H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | BBTBIKXCAUNZMU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |