C17H20FN3O3 — CID 78868120
methyl 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-3-methylpentanoate (PubChem CID 78868120) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is methyl 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 78868120 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | methyl 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)c1ccn(-c2ccc(F)cc2)n1)C(=O)OC |
| InChI | InChI=1S/C17H20FN3O3/c1-4-11(2)15(17(23)24-3)19-16(22)14-9-10-21(20-14)13-7-5-12(18)6-8-13/h5-11,15H,4H2,1-3H3,(H,19,22) |
| InChIKey | WLZABTZWUHTSHB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |