C17H18F3N3O3 — CID 119211933
3-methyl-2-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]pentanoic acid (PubChem CID 119211933) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is 3-methyl-2-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119211933 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-methyl-2-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]pentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1ccn(-c2cccc(C(F)(F)F)c2)n1)C(=O)O |
| InChI | InChI=1S/C17H18F3N3O3/c1-3-10(2)14(16(25)26)21-15(24)13-7-8-23(22-13)12-6-4-5-11(9-12)17(18,19)20/h4-10,14H,3H2,1-2H3,(H,21,24)(H,25,26) |
| InChIKey | XMWJPQWICUINMI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |