C14H16ClF3N4O — CID 119504404
N-[2-(methylamino)ethyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide;hydrochloride (PubChem CID 119504404) has the molecular formula C14H16ClF3N4O and a molecular weight of 348.76 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119504404 |
| Molecular Formula | C14H16ClF3N4O |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-(methylamino)ethyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1ccn(-c2cccc(C(F)(F)F)c2)n1.Cl |
| InChI | InChI=1S/C14H15F3N4O.ClH/c1-18-6-7-19-13(22)12-5-8-21(20-12)11-4-2-3-10(9-11)14(15,16)17;/h2-5,8-9,18H,6-7H2,1H3,(H,19,22);1H |
| InChIKey | PVUDILMVCJKKLC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|