C18H18F3N3O4 — CID 119215328
2-[4-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]oxan-4-yl]acetic acid (PubChem CID 119215328) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-[4-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119215328 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[4-[[1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl]amino]oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2ccn(-c3cccc(C(F)(F)F)c3)n2)CCOCC1 |
| InChI | InChI=1S/C18H18F3N3O4/c19-18(20,21)12-2-1-3-13(10-12)24-7-4-14(23-24)16(27)22-17(11-15(25)26)5-8-28-9-6-17/h1-4,7,10H,5-6,8-9,11H2,(H,22,27)(H,25,26) |
| InChIKey | KUONTPWQEPUQAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |