C16H16F3N5O2 — CID 167745262
N-[(3-carbamoylazetidin-3-yl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 167745262) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-[(3-carbamoylazetidin-3-yl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-[(3-carbamoylazetidin-3-yl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167745262 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[(3-carbamoylazetidin-3-yl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)C1(CNC(=O)c2ccn(-c3cccc(C(F)(F)F)c3)n2)CNC1 |
| InChI | InChI=1S/C16H16F3N5O2/c17-16(18,19)10-2-1-3-11(6-10)24-5-4-12(23-24)13(25)22-9-15(14(20)26)7-21-8-15/h1-6,21H,7-9H2,(H2,20,26)(H,22,25) |
| InChIKey | SLULAPGTTPAUIE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |