C20H32ClNO3Si — CID 102068659
[(3aS,4S,6R,6aR)-4-(4-chlorophenyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102068659) has the molecular formula C20H32ClNO3Si and a molecular weight of 398.02 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-(4-chlorophenyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-4-(4-chlorophenyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102068659 |
| Molecular Formula | C20H32ClNO3Si |
| Molecular Weight | 398.02 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-(4-chlorophenyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)N[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H32ClNO3Si/c1-19(2,3)26(6,7)23-12-15-17-18(25-20(4,5)24-17)16(22-15)13-8-10-14(21)11-9-13/h8-11,15-18,22H,12H2,1-7H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | QEYXFXBFHBRERG-XDNAFOTISA-N |
| XLogP | 4.89 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.02 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|