C21H32N2O3Si — CID 170851373
4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]benzonitrile (PubChem CID 170851373) has the molecular formula C21H32N2O3Si and a molecular weight of 388.58 g/mol. Its IUPAC name is 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]benzonitrile.
| Compound Name | 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 170851373 |
| Molecular Formula | C21H32N2O3Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]benzonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)N[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H32N2O3Si/c1-20(2,3)27(6,7)24-13-16-18-19(26-21(4,5)25-18)17(23-16)15-10-8-14(12-22)9-11-15/h8-11,16-19,23H,13H2,1-7H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | YOXCNQOOGJUMBH-HCXYKTFWSA-N |
| XLogP | 4.11 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|