C26H44N2O5Si — CID 170851372
tert-butyl N-[[4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]phenyl]methyl]carbamate (PubChem CID 170851372) has the molecular formula C26H44N2O5Si and a molecular weight of 492.73 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170851372 |
| Molecular Formula | C26H44N2O5Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | tert-butyl N-[[4-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc([C@@H]2N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C26H44N2O5Si/c1-24(2,3)33-23(29)27-15-17-11-13-18(14-12-17)20-22-21(31-26(7,8)32-22)19(28-20)16-30-34(9,10)25(4,5)6/h11-14,19-22,28H,15-16H2,1-10H3,(H,27,29)/t19-,20+,21-,22+/m1/s1 |
| InChIKey | VNVPJRHBIAMIBC-MBDNFAEBSA-N |
| XLogP | 5.27 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|