C22H34N2O3Si — CID 24813265
4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]benzonitrile (PubChem CID 24813265) has the molecular formula C22H34N2O3Si and a molecular weight of 402.61 g/mol. Its IUPAC name is 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]benzonitrile.
| Compound Name | 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 24813265 |
| Molecular Formula | C22H34N2O3Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]benzonitrile |
| SMILES | CC1(C)O[C@H]2[C@H](CN(Cc3ccc(C#N)cc3)[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H34N2O3Si/c1-21(2,3)28(6,7)25-15-18-20-19(26-22(4,5)27-20)14-24(18)13-17-10-8-16(12-23)9-11-17/h8-11,18-20H,13-15H2,1-7H3/t18-,19+,20-/m1/s1 |
| InChIKey | FHNRZTLPVUWNMT-HSALFYBXSA-N |
| XLogP | 4.28 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|